C17H23N3O3 — CID 110355069
N-[3-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-3-oxopropyl]acetamide (PubChem CID 110355069) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[3-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-3-oxopropyl]acetamide.
| Compound Name | N-[3-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-3-oxopropyl]acetamide |
|---|---|
| PubChem CID | 110355069 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[3-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-3-oxopropyl]acetamide |
| SMILES | CC(=O)NCCC(=O)N1CCc2cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C17H23N3O3/c1-13(21)18-6-4-17(22)20-7-5-14-12-15(2-3-16(14)20)19-8-10-23-11-9-19/h2-3,12H,4-11H2,1H3,(H,18,21) |
| InChIKey | HOCSWBPJTYBECA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|