C21H25N3O2 — CID 110634578
1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-pyridin-3-ylbutan-1-one (PubChem CID 110634578) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-pyridin-3-ylbutan-1-one.
| Compound Name | 1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-pyridin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 110634578 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-pyridin-3-ylbutan-1-one |
| SMILES | O=C(CCCc1cccnc1)N1CCc2cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H25N3O2/c25-21(5-1-3-17-4-2-9-22-16-17)24-10-8-18-15-19(6-7-20(18)24)23-11-13-26-14-12-23/h2,4,6-7,9,15-16H,1,3,5,8,10-14H2 |
| InChIKey | VOMRGKNOHLTPGV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|