C22H26N2O3 — CID 110316103
1-(6-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-phenoxybutan-1-one (PubChem CID 110316103) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-(6-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-phenoxybutan-1-one.
| Compound Name | 1-(6-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 110316103 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-(6-morpholin-4-yl-2,3-dihydroindol-1-yl)-4-phenoxybutan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C22H26N2O3/c25-22(7-4-14-27-20-5-2-1-3-6-20)24-11-10-18-8-9-19(17-21(18)24)23-12-15-26-16-13-23/h1-3,5-6,8-9,17H,4,7,10-16H2 |
| InChIKey | GOKFMGPMGZPEMW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|