C20H21NO4 — CID 110635212
6-methoxy-1-(4-phenoxybutanoyl)-2,3-dihydroquinolin-4-one (PubChem CID 110635212) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 6-methoxy-1-(4-phenoxybutanoyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 6-methoxy-1-(4-phenoxybutanoyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110635212 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 6-methoxy-1-(4-phenoxybutanoyl)-2,3-dihydroquinolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)CCN2C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C20H21NO4/c1-24-16-9-10-18-17(14-16)19(22)11-12-21(18)20(23)8-5-13-25-15-6-3-2-4-7-15/h2-4,6-7,9-10,14H,5,8,11-13H2,1H3 |
| InChIKey | TXBWQLGQMSFKKT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|