C18H17NO3 — CID 110424740
1-[2-(4-methoxyphenyl)acetyl]-2,3-dihydroquinolin-4-one (PubChem CID 110424740) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)acetyl]-2,3-dihydroquinolin-4-one.
| Compound Name | 1-[2-(4-methoxyphenyl)acetyl]-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110424740 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)acetyl]-2,3-dihydroquinolin-4-one |
| SMILES | COc1ccc(CC(=O)N2CCC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H17NO3/c1-22-14-8-6-13(7-9-14)12-18(21)19-11-10-17(20)15-4-2-3-5-16(15)19/h2-9H,10-12H2,1H3 |
| InChIKey | RLTJFVUVUHWZPB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |