C22H25NO5 — CID 66678879
ethyl 2-[4-(6-methoxy-2,3-dihydroindol-1-yl)-4-oxobutoxy]benzoate (PubChem CID 66678879) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is ethyl 2-[4-(6-methoxy-2,3-dihydroindol-1-yl)-4-oxobutoxy]benzoate.
| Compound Name | ethyl 2-[4-(6-methoxy-2,3-dihydroindol-1-yl)-4-oxobutoxy]benzoate |
|---|---|
| PubChem CID | 66678879 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | ethyl 2-[4-(6-methoxy-2,3-dihydroindol-1-yl)-4-oxobutoxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1OCCCC(=O)N1CCc2ccc(OC)cc21 |
| InChI | InChI=1S/C22H25NO5/c1-3-27-22(25)18-7-4-5-8-20(18)28-14-6-9-21(24)23-13-12-16-10-11-17(26-2)15-19(16)23/h4-5,7-8,10-11,15H,3,6,9,12-14H2,1-2H3 |
| InChIKey | BUKNXOWPYDLKEC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|