C16H23N3O — CID 28707300
1-(5-piperazin-1-yl-2,3-dihydroindol-1-yl)butan-1-one (PubChem CID 28707300) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(5-piperazin-1-yl-2,3-dihydroindol-1-yl)butan-1-one.
| Compound Name | 1-(5-piperazin-1-yl-2,3-dihydroindol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 28707300 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-(5-piperazin-1-yl-2,3-dihydroindol-1-yl)butan-1-one |
| SMILES | CCCC(=O)N1CCc2cc(N3CCNCC3)ccc21 |
| InChI | InChI=1S/C16H23N3O/c1-2-3-16(20)19-9-6-13-12-14(4-5-15(13)19)18-10-7-17-8-11-18/h4-5,12,17H,2-3,6-11H2,1H3 |
| InChIKey | FIIHYCQAEACVBY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|