C18H25N3O2 — CID 110414460
6-(4-butanoylpiperazin-1-yl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 110414460) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 6-(4-butanoylpiperazin-1-yl)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(4-butanoylpiperazin-1-yl)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 110414460 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 6-(4-butanoylpiperazin-1-yl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CCCC(=O)N1CCN(c2ccc3c(c2)CCC(=O)N3C)CC1 |
| InChI | InChI=1S/C18H25N3O2/c1-3-4-18(23)21-11-9-20(10-12-21)15-6-7-16-14(13-15)5-8-17(22)19(16)2/h6-7,13H,3-5,8-12H2,1-2H3 |
| InChIKey | NNGSUOBKYDSGRF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|