C21H23ClN4O2 — CID 110414498
N-(3-chlorophenyl)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)piperazine-1-carboxamide (PubChem CID 110414498) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)piperazine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110414498 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-(3-chlorophenyl)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)piperazine-1-carboxamide |
| SMILES | CN1C(=O)CCc2cc(N3CCN(C(=O)Nc4cccc(Cl)c4)CC3)ccc21 |
| InChI | InChI=1S/C21H23ClN4O2/c1-24-19-7-6-18(13-15(19)5-8-20(24)27)25-9-11-26(12-10-25)21(28)23-17-4-2-3-16(22)14-17/h2-4,6-7,13-14H,5,8-12H2,1H3,(H,23,28) |
| InChIKey | CIKKIADKVBJHHW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|