C16H21N3O2 — CID 82537881
1-[4-(1-acetyl-2,3-dihydroindol-5-yl)piperazin-1-yl]ethanone (PubChem CID 82537881) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[4-(1-acetyl-2,3-dihydroindol-5-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(1-acetyl-2,3-dihydroindol-5-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 82537881 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[4-(1-acetyl-2,3-dihydroindol-5-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc3c(c2)CCN3C(C)=O)CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-12(20)17-7-9-18(10-8-17)15-3-4-16-14(11-15)5-6-19(16)13(2)21/h3-4,11H,5-10H2,1-2H3 |
| InChIKey | LYUZCEFXXOWJKN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|