C10H10NO3SZn- — CID 145441295
1-(5-sulfinato-2,3-dihydroindol-1-yl)ethanone;zinc (PubChem CID 145441295) has the molecular formula C10H10NO3SZn- and a molecular weight of 289.65 g/mol. Its IUPAC name is 1-(5-sulfinato-2,3-dihydroindol-1-yl)ethanone;zinc.
| Compound Name | 1-(5-sulfinato-2,3-dihydroindol-1-yl)ethanone;zinc |
|---|---|
| PubChem CID | 145441295 |
| Molecular Formula | C10H10NO3SZn- |
| Molecular Weight | 289.65 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 1-(5-sulfinato-2,3-dihydroindol-1-yl)ethanone;zinc |
| SMILES | CC(=O)N1CCc2cc([S-](=O)=O)ccc21.[Zn] |
| InChI | InChI=1S/C10H10NO3S.Zn/c1-7(12)11-5-4-8-6-9(15(13)14)2-3-10(8)11;/h2-3,6H,4-5H2,1H3;/q-1; |
| InChIKey | JQSTUPSNBJCBDN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.65 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|