C10H10NNaO3S — CID 114287127
sodium 1-acetyl-2,3-dihydroindole-5-sulfinate (PubChem CID 114287127) has the molecular formula C10H10NNaO3S and a molecular weight of 247.25 g/mol. Its IUPAC name is sodium 1-acetyl-2,3-dihydroindole-5-sulfinate.
| Compound Name | sodium 1-acetyl-2,3-dihydroindole-5-sulfinate |
|---|---|
| PubChem CID | 114287127 |
| Molecular Formula | C10H10NNaO3S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | sodium 1-acetyl-2,3-dihydroindole-5-sulfinate |
| SMILES | CC(=O)N1CCc2cc(S(=O)[O-])ccc21.[Na+] |
| InChI | InChI=1S/C10H11NO3S.Na/c1-7(12)11-5-4-8-6-9(15(13)14)2-3-10(8)11;/h2-3,6H,4-5H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | KKGPRDLIXBICQZ-UHFFFAOYSA-M |
| XLogP | -2.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|