C10H9ClNNaO3S — CID 165449431
sodium 1-acetyl-6-chloro-2,3-dihydroindole-5-sulfinate (PubChem CID 165449431) has the molecular formula C10H9ClNNaO3S and a molecular weight of 281.70 g/mol. Its IUPAC name is sodium 1-acetyl-6-chloro-2,3-dihydroindole-5-sulfinate.
| Compound Name | sodium 1-acetyl-6-chloro-2,3-dihydroindole-5-sulfinate |
|---|---|
| PubChem CID | 165449431 |
| Molecular Formula | C10H9ClNNaO3S |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | sodium 1-acetyl-6-chloro-2,3-dihydroindole-5-sulfinate |
| SMILES | CC(=O)N1CCc2cc(S(=O)[O-])c(Cl)cc21.[Na+] |
| InChI | InChI=1S/C10H10ClNO3S.Na/c1-6(13)12-3-2-7-4-10(16(14)15)8(11)5-9(7)12;/h4-5H,2-3H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | OFSOHOBIQNRLHO-UHFFFAOYSA-M |
| XLogP | -1.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|