C11H12INO — CID 178096572
1-(5-iodo-6-methyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 178096572) has the molecular formula C11H12INO and a molecular weight of 301.13 g/mol. Its IUPAC name is 1-(5-iodo-6-methyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(5-iodo-6-methyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 178096572 |
| Molecular Formula | C11H12INO |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 1-(5-iodo-6-methyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc(I)c(C)cc21 |
| InChI | InChI=1S/C11H12INO/c1-7-5-11-9(6-10(7)12)3-4-13(11)8(2)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | RGTBAYBHKXTEMX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|