C11H12FNO3S — CID 59468850
1-(5-fluoro-6-methylsulfonyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 59468850) has the molecular formula C11H12FNO3S and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-(5-fluoro-6-methylsulfonyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(5-fluoro-6-methylsulfonyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 59468850 |
| Molecular Formula | C11H12FNO3S |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-(5-fluoro-6-methylsulfonyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc(F)c(S(C)(=O)=O)cc21 |
| InChI | InChI=1S/C11H12FNO3S/c1-7(14)13-4-3-8-5-9(12)11(6-10(8)13)17(2,15)16/h5-6H,3-4H2,1-2H3 |
| InChIKey | STVRYYFRKDLSLR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |