C12H17NO — CID 159834618
methane;1-(5-methyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 159834618) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is methane;1-(5-methyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | methane;1-(5-methyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 159834618 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | methane;1-(5-methyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | C.CC(=O)N1CCc2cc(C)ccc21 |
| InChI | InChI=1S/C11H13NO.CH4/c1-8-3-4-11-10(7-8)5-6-12(11)9(2)13;/h3-4,7H,5-6H2,1-2H3;1H4 |
| InChIKey | NNXAHFICBDVUIN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |