C14H19NO2 — CID 10657293
tert-butyl 5-methyl-2,3-dihydroindole-1-carboxylate (PubChem CID 10657293) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl 5-methyl-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-methyl-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 10657293 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | tert-butyl 5-methyl-2,3-dihydroindole-1-carboxylate |
| SMILES | Cc1ccc2c(c1)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19NO2/c1-10-5-6-12-11(9-10)7-8-15(12)13(16)17-14(2,3)4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | KFNYRMQJBZAWLH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |