C15H21NO4 — CID 142313343
tert-butyl 5-[hydroxy(methoxy)methyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 142313343) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is tert-butyl 5-[hydroxy(methoxy)methyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-[hydroxy(methoxy)methyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 142313343 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | tert-butyl 5-[hydroxy(methoxy)methyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | COC(O)c1ccc2c(c1)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO4/c1-15(2,3)20-14(18)16-8-7-10-9-11(13(17)19-4)5-6-12(10)16/h5-6,9,13,17H,7-8H2,1-4H3 |
| InChIKey | NSAISCDYUJPYKG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|