C18H28N2O2 — CID 107242303
tert-butyl 5-(pentylamino)-2,3-dihydroindole-1-carboxylate (PubChem CID 107242303) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl 5-(pentylamino)-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-(pentylamino)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 107242303 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl 5-(pentylamino)-2,3-dihydroindole-1-carboxylate |
| SMILES | CCCCCNc1ccc2c(c1)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O2/c1-5-6-7-11-19-15-8-9-16-14(13-15)10-12-20(16)17(21)22-18(2,3)4/h8-9,13,19H,5-7,10-12H2,1-4H3 |
| InChIKey | UWYXLWAUNAQHHI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|