C15H19FN2O3 — CID 59468798
tert-butyl 6-acetamido-5-fluoro-2,3-dihydroindole-1-carboxylate (PubChem CID 59468798) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is tert-butyl 6-acetamido-5-fluoro-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 6-acetamido-5-fluoro-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 59468798 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | tert-butyl 6-acetamido-5-fluoro-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(=O)Nc1cc2c(cc1F)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19FN2O3/c1-9(19)17-12-8-13-10(7-11(12)16)5-6-18(13)14(20)21-15(2,3)4/h7-8H,5-6H2,1-4H3,(H,17,19) |
| InChIKey | HMEXOPLNVUZJIU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |