C14H19NO3 — CID 10514762
tert-butyl 5-methoxy-2,3-dihydroindole-1-carboxylate (PubChem CID 10514762) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is tert-butyl 5-methoxy-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-methoxy-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 10514762 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | tert-butyl 5-methoxy-2,3-dihydroindole-1-carboxylate |
| SMILES | COc1ccc2c(c1)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19NO3/c1-14(2,3)18-13(16)15-8-7-10-9-11(17-4)5-6-12(10)15/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | JXRHJQZYRSELDB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |