C14H18FNO2 — CID 14175818
tert-butyl 6-fluoro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 14175818) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is tert-butyl 6-fluoro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 6-fluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 14175818 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | tert-butyl 6-fluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2cc(F)ccc21 |
| InChI | InChI=1S/C14H18FNO2/c1-14(2,3)18-13(17)16-8-4-5-10-9-11(15)6-7-12(10)16/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | PJQAIRWPBWDUHD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |