About tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate
tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 117469487) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| PubChem CID | 117469487 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(N)Cc1ccc2c(c1)CCCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-12(18)10-13-7-8-15-14(11-13)6-5-9-19(15)16(20)21-17(2,3)4/h7-8,11-12H,5-6,9-10,18H2,1-4H3 |
| InChIKey | ZBAXONDZIFCTCG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate (CID 117469487) is tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate is CC(N)Cc1ccc2c(c1)CCCN2C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is ZBAXONDZIFCTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-12(18)10-13-7-8-15-14(11-13)6-5-9-19(15)16(20)21-17(2,3)4/h7-8,11-12H,5-6,9-10,18H2,1-4H3.
What are the key properties of tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate?
tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 290.41 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-(2-aminopropyl)-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 117469487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).