C11H10F3NO — CID 73012338
1-[5-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 73012338) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 73012338 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-[5-(trifluoromethyl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H10F3NO/c1-7(16)15-5-4-8-6-9(11(12,13)14)2-3-10(8)15/h2-3,6H,4-5H2,1H3 |
| InChIKey | FYUBCCLLRJETBQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |