C22H24F3N3OS — CID 156725796
1-[5-[4-[3-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]ethanone (PubChem CID 156725796) has the molecular formula C22H24F3N3OS and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[5-[4-[3-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[4-[3-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 156725796 |
| Molecular Formula | C22H24F3N3OS |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[5-[4-[3-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(SN3CCN(c4cc(C)cc(C(F)(F)F)c4)CC3)ccc21 |
| InChI | InChI=1S/C22H24F3N3OS/c1-15-11-18(22(23,24)25)14-19(12-15)26-7-9-27(10-8-26)30-20-3-4-21-17(13-20)5-6-28(21)16(2)29/h3-4,11-14H,5-10H2,1-2H3 |
| InChIKey | FXKVNWGNFYFFRH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|