C24H23F6N3O3S — CID 91216839
4-[5-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]-4-oxobutanoic acid (PubChem CID 91216839) has the molecular formula C24H23F6N3O3S and a molecular weight of 547.52 g/mol. Its IUPAC name is 4-[5-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91216839 |
| Molecular Formula | C24H23F6N3O3S |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 4-[5-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfanyl-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1CCc2cc(SN3CCN(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3)ccc21 |
| InChI | InChI=1S/C24H23F6N3O3S/c25-23(26,27)16-12-17(24(28,29)30)14-18(13-16)31-7-9-32(10-8-31)37-19-1-2-20-15(11-19)5-6-33(20)21(34)3-4-22(35)36/h1-2,11-14H,3-10H2,(H,35,36) |
| InChIKey | ZUEDANFAPBYWSU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|