C23H27ClN4O4S — CID 143931056
4-[5-[[4-(3-chloro-2-methylphenyl)piperazin-1-yl]sulfanyl-hydroxyamino]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid (PubChem CID 143931056) has the molecular formula C23H27ClN4O4S and a molecular weight of 491.01 g/mol. Its IUPAC name is 4-[5-[[4-(3-chloro-2-methylphenyl)piperazin-1-yl]sulfanyl-hydroxyamino]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-[[4-(3-chloro-2-methylphenyl)piperazin-1-yl]sulfanyl-hydroxyamino]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 143931056 |
| Molecular Formula | C23H27ClN4O4S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-[5-[[4-(3-chloro-2-methylphenyl)piperazin-1-yl]sulfanyl-hydroxyamino]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
| SMILES | Cc1c(Cl)cccc1N1CCN(SN(O)c2ccc3c(c2)CCN3C(=O)CCC(=O)O)CC1 |
| InChI | InChI=1S/C23H27ClN4O4S/c1-16-19(24)3-2-4-20(16)25-11-13-26(14-12-25)33-28(32)18-5-6-21-17(15-18)9-10-27(21)22(29)7-8-23(30)31/h2-6,15,32H,7-14H2,1H3,(H,30,31) |
| InChIKey | DPBQXTDLZBPFLT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|