C13H17BrN2O4S — CID 46503628
1-acetyl-5-bromo-N-(2-methoxyethyl)-2,3-dihydroindole-6-sulfonamide (PubChem CID 46503628) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is 1-acetyl-5-bromo-N-(2-methoxyethyl)-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-acetyl-5-bromo-N-(2-methoxyethyl)-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 46503628 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-acetyl-5-bromo-N-(2-methoxyethyl)-2,3-dihydroindole-6-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc2c(cc1Br)CCN2C(C)=O |
| InChI | InChI=1S/C13H17BrN2O4S/c1-9(17)16-5-3-10-7-11(14)13(8-12(10)16)21(18,19)15-4-6-20-2/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | LIGNSKRFGFPNCC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|