C18H19BrN2O5S — CID 46374657
1-acetyl-5-bromo-N-(3,4-dimethoxyphenyl)-2,3-dihydroindole-6-sulfonamide (PubChem CID 46374657) has the molecular formula C18H19BrN2O5S and a molecular weight of 455.33 g/mol. Its IUPAC name is 1-acetyl-5-bromo-N-(3,4-dimethoxyphenyl)-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-acetyl-5-bromo-N-(3,4-dimethoxyphenyl)-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 46374657 |
| Molecular Formula | C18H19BrN2O5S |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 1-acetyl-5-bromo-N-(3,4-dimethoxyphenyl)-2,3-dihydroindole-6-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc3c(cc2Br)CCN3C(C)=O)cc1OC |
| InChI | InChI=1S/C18H19BrN2O5S/c1-11(22)21-7-6-12-8-14(19)18(10-15(12)21)27(23,24)20-13-4-5-16(25-2)17(9-13)26-3/h4-5,8-10,20H,6-7H2,1-3H3 |
| InChIKey | DZEBQNGGXZUDSX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |