C19H19BrN2O5S — CID 46504139
ethyl 3-[(1-acetyl-5-bromo-2,3-dihydroindol-6-yl)sulfonylamino]benzoate (PubChem CID 46504139) has the molecular formula C19H19BrN2O5S and a molecular weight of 467.34 g/mol. Its IUPAC name is ethyl 3-[(1-acetyl-5-bromo-2,3-dihydroindol-6-yl)sulfonylamino]benzoate.
| Compound Name | ethyl 3-[(1-acetyl-5-bromo-2,3-dihydroindol-6-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 46504139 |
| Molecular Formula | C19H19BrN2O5S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | ethyl 3-[(1-acetyl-5-bromo-2,3-dihydroindol-6-yl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NS(=O)(=O)c2cc3c(cc2Br)CCN3C(C)=O)c1 |
| InChI | InChI=1S/C19H19BrN2O5S/c1-3-27-19(24)14-5-4-6-15(9-14)21-28(25,26)18-11-17-13(10-16(18)20)7-8-22(17)12(2)23/h4-6,9-11,21H,3,7-8H2,1-2H3 |
| InChIKey | WEWYOCSYWAKGGA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |