C12H11NOS — CID 54513861
1-(5,6-dihydrothieno[3,2-f]indol-7-yl)ethanone (PubChem CID 54513861) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 1-(5,6-dihydrothieno[3,2-f]indol-7-yl)ethanone.
| Compound Name | 1-(5,6-dihydrothieno[3,2-f]indol-7-yl)ethanone |
|---|---|
| PubChem CID | 54513861 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1-(5,6-dihydrothieno[3,2-f]indol-7-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc3ccsc3cc21 |
| InChI | InChI=1S/C12H11NOS/c1-8(14)13-4-2-9-6-10-3-5-15-12(10)7-11(9)13/h3,5-7H,2,4H2,1H3 |
| InChIKey | YLALIJWGRSFKPX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |