C11H10N2O — CID 59468783
1-(6-isocyano-2,3-dihydroindol-1-yl)ethanone (PubChem CID 59468783) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(6-isocyano-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(6-isocyano-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 59468783 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-(6-isocyano-2,3-dihydroindol-1-yl)ethanone |
| SMILES | [C-]#[N+]c1ccc2c(c1)N(C(C)=O)CC2 |
| InChI | InChI=1S/C11H10N2O/c1-8(14)13-6-5-9-3-4-10(12-2)7-11(9)13/h3-4,7H,5-6H2,1H3 |
| InChIKey | OFMLLUMUMVPSGI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|