C18H14N2O3 — CID 168516279
2-(1-acetyl-2,3-dihydroindol-6-yl)isoindole-1,3-dione (PubChem CID 168516279) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-(1-acetyl-2,3-dihydroindol-6-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-acetyl-2,3-dihydroindol-6-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516279 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(1-acetyl-2,3-dihydroindol-6-yl)isoindole-1,3-dione |
| SMILES | CC(=O)N1CCc2ccc(N3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C18H14N2O3/c1-11(21)19-9-8-12-6-7-13(10-16(12)19)20-17(22)14-4-2-3-5-15(14)18(20)23/h2-7,10H,8-9H2,1H3 |
| InChIKey | QYFNOXCJWFPUGA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|