C19H16N2O3 — CID 168517342
2-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)isoindole-1,3-dione (PubChem CID 168517342) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517342 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)isoindole-1,3-dione |
| SMILES | CC(=O)N1c2ccc(N3C(=O)c4ccccc4C3=O)cc2CC1C |
| InChI | InChI=1S/C19H16N2O3/c1-11-9-13-10-14(7-8-17(13)20(11)12(2)22)21-18(23)15-5-3-4-6-16(15)19(21)24/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | TUOZNYBECMZNRZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|