C26H19ClN2O5 — CID 4804288
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4804288) has the molecular formula C26H19ClN2O5 and a molecular weight of 474.90 g/mol. Its IUPAC name is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4804288 |
| Molecular Formula | C26H19ClN2O5 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC1Cc2ccccc2N1C(=O)COC(=O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C26H19ClN2O5/c1-15-12-16-4-2-3-5-22(16)28(15)23(30)14-34-26(33)17-6-11-20-21(13-17)25(32)29(24(20)31)19-9-7-18(27)8-10-19/h2-11,13,15H,12,14H2,1H3 |
| InChIKey | TUVSLSNCOBGLBR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|