C23H21ClN2O6 — CID 2410518
[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2410518) has the molecular formula C23H21ClN2O6 and a molecular weight of 456.88 g/mol. Its IUPAC name is [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2410518 |
| Molecular Formula | C23H21ClN2O6 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Cl)cc2)C3=O)C[C@@H](C)O1 |
| InChI | InChI=1S/C23H21ClN2O6/c1-13-10-25(11-14(2)32-13)20(27)12-31-23(30)15-3-8-18-19(9-15)22(29)26(21(18)28)17-6-4-16(24)5-7-17/h3-9,13-14H,10-12H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | UAUDAAZUSUNGPS-ZIAGYGMSSA-N |
| XLogP | 2.93 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|