C22H28N2O6 — CID 2590353
[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2590353) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2590353 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)OCC(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2C1=O |
| InChI | InChI=1S/C22H28N2O6/c1-13(2)7-8-24-20(26)17-6-5-16(9-18(17)21(24)27)22(28)29-12-19(25)23-10-14(3)30-15(4)11-23/h5-6,9,13-15H,7-8,10-12H2,1-4H3/t14-,15+ |
| InChIKey | MIWCQUVPZAHHGJ-GASCZTMLSA-N |
| XLogP | 2.12 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|