C27H24ClNO5 — CID 3963713
[2-(1-adamantyl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3963713) has the molecular formula C27H24ClNO5 and a molecular weight of 477.94 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3963713 |
| Molecular Formula | C27H24ClNO5 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCC(=O)C12CC3CC(CC(C3)C1)C2)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C27H24ClNO5/c28-19-2-4-20(5-3-19)29-24(31)21-6-1-18(10-22(21)25(29)32)26(33)34-14-23(30)27-11-15-7-16(12-27)9-17(8-15)13-27/h1-6,10,15-17H,7-9,11-14H2 |
| InChIKey | FOFXUQYETKTRRA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|