C20H19N3O3 — CID 168518953
2-[4-(4-acetylpiperazin-1-yl)phenyl]isoindole-1,3-dione (PubChem CID 168518953) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[4-(4-acetylpiperazin-1-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-acetylpiperazin-1-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518953 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[4-(4-acetylpiperazin-1-yl)phenyl]isoindole-1,3-dione |
| SMILES | CC(=O)N1CCN(c2ccc(N3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C20H19N3O3/c1-14(24)21-10-12-22(13-11-21)15-6-8-16(9-7-15)23-19(25)17-4-2-3-5-18(17)20(23)26/h2-9H,10-13H2,1H3 |
| InChIKey | TYBKOJTUEJOBSS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|