C25H23N3O2 — CID 168519018
2-[4-(4-benzylpiperazin-1-yl)phenyl]isoindole-1,3-dione (PubChem CID 168519018) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperazin-1-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-benzylpiperazin-1-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519018 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[4-(4-benzylpiperazin-1-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H23N3O2/c29-24-22-8-4-5-9-23(22)25(30)28(24)21-12-10-20(11-13-21)27-16-14-26(15-17-27)18-19-6-2-1-3-7-19/h1-13H,14-18H2 |
| InChIKey | PWYMDENAFVLPCU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|