C10H9BrINO — CID 14059145
1-(6-bromo-7-iodo-2,3-dihydroindol-1-yl)ethanone (PubChem CID 14059145) has the molecular formula C10H9BrINO and a molecular weight of 366.00 g/mol. Its IUPAC name is 1-(6-bromo-7-iodo-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(6-bromo-7-iodo-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 14059145 |
| Molecular Formula | C10H9BrINO |
| Molecular Weight | 366.00 g/mol |
| Exact Mass | 364.89 |
| IUPAC Name | 1-(6-bromo-7-iodo-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2ccc(Br)c(I)c21 |
| InChI | InChI=1S/C10H9BrINO/c1-6(14)13-5-4-7-2-3-8(11)9(12)10(7)13/h2-3H,4-5H2,1H3 |
| InChIKey | IPXLNYPIQRNSTO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.00 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|