C12H15NO — CID 101108036
1-(7-ethyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 101108036) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(7-ethyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(7-ethyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 101108036 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(7-ethyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CCc1cccc2c1N(C(C)=O)CC2 |
| InChI | InChI=1S/C12H15NO/c1-3-10-5-4-6-11-7-8-13(9(2)14)12(10)11/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | UEKJMDCXARSVHK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |