C14H23N — CID 145401425
1,8-diethyl-3,4-dihydro-2H-quinoline;methane (PubChem CID 145401425) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1,8-diethyl-3,4-dihydro-2H-quinoline;methane.
| Compound Name | 1,8-diethyl-3,4-dihydro-2H-quinoline;methane |
|---|---|
| PubChem CID | 145401425 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1,8-diethyl-3,4-dihydro-2H-quinoline;methane |
| SMILES | C.CCc1cccc2c1N(CC)CCC2 |
| InChI | InChI=1S/C13H19N.CH4/c1-3-11-7-5-8-12-9-6-10-14(4-2)13(11)12;/h5,7-8H,3-4,6,9-10H2,1-2H3;1H4 |
| InChIKey | YRLIBJASTBQMOW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |