About (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol
(6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol (PubChem CID 15053146) has the molecular formula C12H16BrNO
and a molecular weight of 270.17 g/mol. Its IUPAC name is (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol.
Molecular Properties
| Compound Name | (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol |
| PubChem CID | 15053146 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol |
| SMILES | CCN1CCCc2cc(Br)cc(CO)c21 |
| InChI | InChI=1S/C12H16BrNO/c1-2-14-5-3-4-9-6-11(13)7-10(8-15)12(9)14/h6-7,15H,2-5,8H2,1H3 |
| InChIKey | PVAOTDBWUKBGLT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol?
The IUPAC name of (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol (CID 15053146) is (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol.
What is the SMILES notation for (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol?
The canonical SMILES for (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol is CCN1CCCc2cc(Br)cc(CO)c21.
What is the InChIKey of (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol?
The InChIKey is PVAOTDBWUKBGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO/c1-2-14-5-3-4-9-6-11(13)7-10(8-15)12(9)14/h6-7,15H,2-5,8H2,1H3.
What are the key properties of (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol?
(6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol has a molecular weight of 270.17 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-1-ethyl-3,4-dihydro-2H-quinolin-8-yl)methanol is sourced from PubChem (CID 15053146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).