About 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene
7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 70876138) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
Analyze 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
The IUPAC name of 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (CID 70876138) is 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
What is the SMILES notation for 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
The canonical SMILES for 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene is CCc1cc2c3c(c1)CCCN3CCC2.
What is the InChIKey of 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
The InChIKey is QGWYYKWMFMNQQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-2-11-9-12-5-3-7-15-8-4-6-13(10-11)14(12)15/h9-10H,2-8H2,1H3.
What are the key properties of 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene has a molecular weight of 201.31 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene is sourced from PubChem (CID 70876138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).