C12H15N — CID 164919435
1-ethyl-2,3,4,6-tetrahydrocyclopropa[g]quinoline (PubChem CID 164919435) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-ethyl-2,3,4,6-tetrahydrocyclopropa[g]quinoline.
| Compound Name | 1-ethyl-2,3,4,6-tetrahydrocyclopropa[g]quinoline |
|---|---|
| PubChem CID | 164919435 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-ethyl-2,3,4,6-tetrahydrocyclopropa[g]quinoline |
| SMILES | CCN1CCCc2cc3c(cc21)C3 |
| InChI | InChI=1S/C12H15N/c1-2-13-5-3-4-9-6-10-7-11(10)8-12(9)13/h6,8H,2-5,7H2,1H3 |
| InChIKey | HNTBKYGVYTVZEZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |