C13H20N2O — CID 178094699
7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 178094699) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 178094699 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | CCOc1cc2c(cc1N)CCCN2CC |
| InChI | InChI=1S/C13H20N2O/c1-3-15-7-5-6-10-8-11(14)13(16-4-2)9-12(10)15/h8-9H,3-7,14H2,1-2H3 |
| InChIKey | GNGNFBYLMPSJCP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|