About 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine
7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 178094699) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine.
Molecular Properties
| Compound Name | 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine |
| PubChem CID | 178094699 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | CCOc1cc2c(cc1N)CCCN2CC |
| InChI | InChI=1S/C13H20N2O/c1-3-15-7-5-6-10-8-11(14)13(16-4-2)9-12(10)15/h8-9H,3-7,14H2,1-2H3 |
| InChIKey | GNGNFBYLMPSJCP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine?
The IUPAC name of 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine (CID 178094699) is 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine.
What is the SMILES notation for 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine?
The canonical SMILES for 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine is CCOc1cc2c(cc1N)CCCN2CC.
What is the InChIKey of 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine?
The InChIKey is GNGNFBYLMPSJCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-3-15-7-5-6-10-8-11(14)13(16-4-2)9-12(10)15/h8-9H,3-7,14H2,1-2H3.
What are the key properties of 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine?
7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine has a molecular weight of 220.32 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-1-ethyl-3,4-dihydro-2H-quinolin-6-amine is sourced from PubChem (CID 178094699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).