C13H17N — CID 170444076
6-ethenyl-1-ethyl-3,4-dihydro-2H-quinoline (PubChem CID 170444076) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 6-ethenyl-1-ethyl-3,4-dihydro-2H-quinoline.
| Compound Name | 6-ethenyl-1-ethyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 170444076 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 6-ethenyl-1-ethyl-3,4-dihydro-2H-quinoline |
| SMILES | C=Cc1ccc2c(c1)CCCN2CC |
| InChI | InChI=1S/C13H17N/c1-3-11-7-8-13-12(10-11)6-5-9-14(13)4-2/h3,7-8,10H,1,4-6,9H2,2H3 |
| InChIKey | GSRHYEUJUUPWJS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|