C20H24N4S — CID 6109074
1-[(Z)-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]-3-(3-methylphenyl)thiourea (PubChem CID 6109074) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is 1-[(Z)-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(Z)-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 6109074 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[(Z)-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]-3-(3-methylphenyl)thiourea |
| SMILES | CCN1CCCc2cc(/C=N\NC(=S)Nc3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C20H24N4S/c1-3-24-11-5-7-17-13-16(9-10-19(17)24)14-21-23-20(25)22-18-8-4-6-15(2)12-18/h4,6,8-10,12-14H,3,5,7,11H2,1-2H3,(H2,22,23,25)/b21-14- |
| InChIKey | ISEWVCNUUXJXQT-STZFKDTASA-N |
| XLogP | 4.09 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|