C21H26N4S — CID 6260015
1-(4-methylphenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea (PubChem CID 6260015) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea.
| Compound Name | 1-(4-methylphenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6260015 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea |
| SMILES | CCCN1CCCc2cc(/C=N\NC(=S)Nc3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C21H26N4S/c1-3-12-25-13-4-5-18-14-17(8-11-20(18)25)15-22-24-21(26)23-19-9-6-16(2)7-10-19/h6-11,14-15H,3-5,12-13H2,1-2H3,(H2,23,24,26)/b22-15- |
| InChIKey | COMDIKXQSWPDOP-JCMHNJIXSA-N |
| XLogP | 4.48 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|